For research use only. Not for therapeutic Use.
2,4-Dibromophenol (Cat No.:R017818) is a chemical compound with the molecular formula C6H4Br2O. It is a derivative of phenol, featuring two bromine atoms substituted on the phenyl ring at positions 2 and 4. This compound is used in various applications, including as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and dyes. Its bromine substitutions contribute to its reactivity and potential to participate in diverse chemical reactions. 2,4-Dibromophenol’s structure makes it valuable in creating compounds with modified properties, supporting its role as a versatile building block in organic synthesis.
CAS Number | 615-58-7 |
Synonyms | NSC 5723; NSC 6213 |
Molecular Formula | C6H4Br2O |
Purity | ≥95% |
Storage | room temp |
IUPAC Name | 2,4-dibromophenol |
InChI | InChI=1S/C6H4Br2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H |
InChIKey | FAXWFCTVSHEODL-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Br)Br)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |