For research use only. Not for therapeutic Use.
2,4-Dichloro-5-difluoromethyl-1,3-thiazole is a heterocyclic compound featuring a thiazole ring with dichlorine substituents at the 2 and 4 positions, and a difluoromethyl group at the 5 position. This unique structure enhances its chemical reactivity and electronic properties, making it valuable in organic synthesis and materials science. The halogen substituents can facilitate nucleophilic substitutions, while the difluoromethyl group may influence lipophilicity and biological activity. This compound is potentially useful as an intermediate in the development of pharmaceuticals and agrochemicals.
| Catalog Number | M006820 |
| CAS Number | 105315-43-3 |
| Molecular Formula | C4HCl2F2NS |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | 2,4-dichloro-5-(difluoromethyl)-1,3-thiazole |
| InChI | InChI=1S/C4HCl2F2NS/c5-2-1(3(7)8)10-4(6)9-2/h3H |
| InChIKey | BMNCFMVAGOFKJA-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(S1)Cl)Cl)C(F)F |
