For research use only. Not for therapeutic Use.
2,4-Dichloro-5-(ethoxymethyl)pyrimidine(Cat No.:L040187)is a high-purity heterocyclic compound widely used in pharmaceutical and chemical research. This molecule features a pyrimidine core with chlorine atoms at the 2 and 4 positions and an ethoxymethyl group at the 5 position, making it a valuable intermediate in the synthesis of bioactive molecules, including potential drug candidates and agrochemicals. Its unique structure allows for selective reactivity in various chemical transformations. 2,4-Dichloro-5-(ethoxymethyl)pyrimidine is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research.
CAS Number | 7627-39-6 |
Molecular Formula | C7H8Cl2N2O |
Purity | ≥95% |
IUPAC Name | 2,4-dichloro-5-(ethoxymethyl)pyrimidine |
InChI | InChI=1S/C7H8Cl2N2O/c1-2-12-4-5-3-10-7(9)11-6(5)8/h3H,2,4H2,1H3 |
InChIKey | RZVUFAWKJMGXSK-UHFFFAOYSA-N |
SMILES | CCOCC1=CN=C(N=C1Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |