For research use only. Not for therapeutic Use.
2′,4′-Dichloro-5′-fluoroacetophenone(Cat No.:L019992)is a chemical compound with the formula C8H5Cl2FO. It features an acetophenone core substituted with two chlorine atoms and one fluorine atom. This structure imparts significant reactivity, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The ketone group in acetophenone facilitates various organic reactions, including condensations and reductions. The halogen substitutions enhance its electrophilic properties, allowing for targeted synthesis of complex molecules. This compound is especially useful in developing new compounds where precise structural and electronic modifications are required.
CAS Number | 704-10-9 |
Molecular Formula | C8H5Cl2FO |
Purity | ≥95% |
IUPAC Name | 1-(2,4-dichloro-5-fluorophenyl)ethanone |
InChI | InChI=1S/C8H5Cl2FO/c1-4(12)5-2-8(11)7(10)3-6(5)9/h2-3H,1H3 |
InChIKey | FAKJFAMIABOKBW-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC(=C(C=C1Cl)Cl)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |