For research use only. Not for therapeutic Use.
2,4-Dichloro-5-fluorobromobenzene(Cat No.:M051017)is a halogenated aromatic compound featuring a unique combination of chlorine, fluorine, and bromine atoms attached to a benzene ring. This structure imparts high reactivity, making it a valuable intermediate in the synthesis of agrochemicals, pharmaceuticals, and specialty chemicals. The presence of multiple halogens allows for diverse functionalization through nucleophilic substitution reactions, enhancing the compound’s utility in creating complex molecules with specific properties. 2,4-Dichloro-5-fluorobromobenzene is crucial in the development of new materials and active compounds that require precise electronic and steric characteristics.
Catalog Number | M051017 |
CAS Number | 1481-63-6 |
Molecular Formula | C6H2BrCl2F |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 1-bromo-2,4-dichloro-5-fluorobenzene |
InChI | InChI=1S/C6H2BrCl2F/c7-3-1-6(10)5(9)2-4(3)8/h1-2H |
InChIKey | HNCWLJLWAVCZDM-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Br)Cl)Cl)F |