For research use only. Not for therapeutic Use.
2,4-Dichloro-5-fluoropyridine(CAT: L039686) is a halogenated pyridine derivative widely used as a versatile intermediate in pharmaceutical and agrochemical synthesis. The presence of two chlorine atoms at the 2- and 4-positions and a fluorine atom at the 5-position on the pyridine ring increases its reactivity and allows for selective functionalization, making it suitable for building complex molecular structures. This compound’s halogen substitutions enhance lipophilicity and metabolic stability, contributing to favorable pharmacokinetic properties when used in drug design. It is often employed in cross-coupling reactions (e.g., Suzuki, Heck) and nucleophilic substitution reactions, enabling the synthesis of various biologically active compounds and specialized materials.
CAS Number | 189281-48-9 |
Molecular Formula | C5H2Cl2FN |
Purity | ≥95% |
IUPAC Name | 2,4-dichloro-5-fluoropyridine |
InChI | InChI=1S/C5H2Cl2FN/c6-3-1-5(7)9-2-4(3)8/h1-2H |
InChIKey | SZVOULWPEYQUJX-UHFFFAOYSA-N |