For research use only. Not for therapeutic Use.
2,4-Dichloro-5-fluoroquinoline(Cat No.:L007535), is a chemical compound featuring a quinoline ring with chlorine atoms at the 2nd and 4th positions and a fluorine atom at the 5th position. This compound is essential in medicinal chemistry and drug discovery research. Its unique structure and reactivity make it valuable for designing and developing potential therapeutic agents. Researchers study its interactions with biological targets, aiming to create novel drugs for various medical applications.
CAS Number | 2092047-08-8 |
Molecular Formula | C9H4Cl2FN |
Purity | ≥95% |
IUPAC Name | 2,4-dichloro-5-fluoroquinoline |
InChI | InChI=1S/C9H4Cl2FN/c10-5-4-8(11)13-7-3-1-2-6(12)9(5)7/h1-4H |
InChIKey | KVYICSLMOSRRIQ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=C1)F)C(=CC(=N2)Cl)Cl |