For research use only. Not for therapeutic Use.
2,4-Dichloro-5,6-dihydrobenzo[h]quinazoline(CAT: L019683) is a high-purity heterocyclic compound featuring a quinazoline framework with dichloro substitutions at the 2- and 4-positions. Its partially saturated structure adds versatility, making it a valuable intermediate in pharmaceutical and organic synthesis. This compound is often utilized in the development of bioactive molecules, including kinase inhibitors, antimicrobial agents, and other therapeutic candidates. With excellent chemical stability and reactivity, 2,4-Dichloro-5,6-dihydrobenzo[h]quinazoline supports innovative research in medicinal chemistry, fine chemical production, and advanced material science applications.
CAS Number | 1186410-71-8 |
Molecular Formula | C12H8Cl2N2 |
Purity | ≥95% |
IUPAC Name | 2,4-dichloro-5,6-dihydrobenzo[h]quinazoline |
InChI | InChI=1S/C12H8Cl2N2/c13-11-9-6-5-7-3-1-2-4-8(7)10(9)15-12(14)16-11/h1-4H,5-6H2 |
InChIKey | LWVLIYHECBKBAE-UHFFFAOYSA-N |
SMILES | C1CC2=C(C3=CC=CC=C31)N=C(N=C2Cl)Cl |