For research use only. Not for therapeutic Use.
2,4-Dichloro-6-methoxypyrimidine is a heterocyclic compound featuring chlorine atoms at the 2- and 4-positions and a methoxy group at the 6-position of the pyrimidine ring. This compound is a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its reactivity in substitution and condensation reactions. It is often used in the creation of bioactive molecules, such as antiviral agents, herbicides, and fungicides. Researchers leverage 2,4-Dichloro-6-methoxypyrimidine in medicinal chemistry to explore new therapeutic options and improve the efficacy of drug candidates through targeted modifications.
CAS Number | 43212-41-5 |
Synonyms | 2,6-Dichloro-4-methoxypyrimidine |
Molecular Formula | C5H4Cl2N2O |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2,4-dichloro-6-methoxypyrimidine |
InChI | InChI=1S/C5H4Cl2N2O/c1-10-4-2-3(6)8-5(7)9-4/h2H,1H3 |
InChIKey | ZSNZDRHTTWBNGI-UHFFFAOYSA-N |
SMILES | COC1=CC(=NC(=N1)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |