For research use only. Not for therapeutic Use.
2,4-Dichloro-6-nitroquinoline(Cat No.:L017675)is a halogenated quinoline derivative featuring chlorine atoms at the 2 and 4 positions and a nitro group at the 6 position. This compound is valuable in pharmaceutical research and organic synthesis as a building block for developing bioactive molecules, including potential anticancer, antibacterial, and antiviral agents. The dichloro and nitro substituents enhance the compound’s reactivity, allowing for diverse chemical modifications and facilitating the creation of complex molecular frameworks. High purity ensures its reliability in advanced medicinal chemistry and drug development applications.
CAS Number | 408523-59-1 |
Molecular Formula | C9H4Cl2N2O2 |
Purity | ≥95% |
IUPAC Name | 2,4-dichloro-6-nitroquinoline |
InChI | InChI=1S/C9H4Cl2N2O2/c10-7-4-9(11)12-8-2-1-5(13(14)15)3-6(7)8/h1-4H |
InChIKey | ZHHMYLFTTXCPRJ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=CC(=N2)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |