For research use only. Not for therapeutic Use.
2,4-dichloro-N-pentylbenzamide(Cat No.:L006877), is an organic compound utilized in chemical research and synthesis. Its molecular structure includes a benzamide group substituted with two chlorine atoms at the 2nd and 4th positions and a pentyl chain attached to the nitrogen atom. This compound serves as a valuable intermediate in the creation of various organic derivatives. Researchers use it to explore structure-activity relationships and develop new compounds for potential applications in pharmaceuticals, agrochemicals, and materials science.
CAS Number | 2447-88-3 |
Molecular Formula | C12H15Cl2NO |
Purity | ≥95% |
IUPAC Name | 2,4-dichloro-N-pentylbenzamide |
InChI | InChI=1S/C12H15Cl2NO/c1-2-3-4-7-15-12(16)10-6-5-9(13)8-11(10)14/h5-6,8H,2-4,7H2,1H3,(H,15,16) |
InChIKey | QLFOKAOJSCZXRM-UHFFFAOYSA-N |
SMILES | CCCCCNC(=O)C1=C(C=C(C=C1)Cl)Cl |