For research use only. Not for therapeutic Use.
2,4-Dichlorophenyl acetate(CAT: L000200) is an important compound in organic chemistry. It is utilized as a precursor in the synthesis of various organic compounds, including agrochemicals and pharmaceutical intermediates. Its chlorinated structure plays a crucial role in introducing specific functional groups during organic synthesis.
CAS Number | 6341-97-5 |
Molecular Formula | C8H6Cl2O2 |
Purity | ≥95% |
IUPAC Name | (2,4-dichlorophenyl) acetate |
InChI | InChI=1S/C8H6Cl2O2/c1-5(11)12-8-3-2-6(9)4-7(8)10/h2-4H,1H3 |
InChIKey | KGXUYVOKSRCTEK-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |