For research use only. Not for therapeutic Use.
2,4-Dichloroquinazoline-8-carbonitrile(Cat No.:L006708), is a chemical compound featuring a quinazoline ring substituted with chlorine atoms at the 2nd and 4th positions, along with a cyano group at the 8th position. This compound is vital in organic synthesis, serving as an important intermediate for the development of various complex molecules, especially in pharmaceutical and agrochemical research. Its specific structure offers diverse reactivity, allowing its incorporation into specialized organic compounds.
CAS Number | 1150617-71-2 |
Molecular Formula | C9H3Cl2N3 |
Purity | ≥95% |
IUPAC Name | 2,4-dichloroquinazoline-8-carbonitrile |
InChI | InChI=1S/C9H3Cl2N3/c10-8-6-3-1-2-5(4-12)7(6)13-9(11)14-8/h1-3H |
InChIKey | LUCPYAXUBBOULM-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=C1)C(=NC(=N2)Cl)Cl)C#N |