For research use only. Not for therapeutic Use.
2,4-Difluoro-3-iodoaniline(CAT: L021803) is a halogenated aromatic amine widely used as an intermediate in organic synthesis, particularly in pharmaceutical and agrochemical development. The molecule’s structure, with fluorine atoms at the 2- and 4- positions and an iodine atom at the 3-position on the aniline ring, provides unique reactivity and enables selective functionalization. Its combination of halogens enhances the compound’s stability and facilitates cross-coupling reactions, such as Suzuki or Sonogashira couplings. 2,4-Difluoro-3-iodoaniline is a valuable building block for creating complex heterocyclic compounds and bioactive molecules in advanced chemical research and drug discovery.
CAS Number | 1437316-91-0 |
Molecular Formula | C6H4F2IN |
Purity | ≥95% |
IUPAC Name | 2,4-difluoro-3-iodoaniline |
InChI | InChI=1S/C6H4F2IN/c7-3-1-2-4(10)5(8)6(3)9/h1-2H,10H2 |
InChIKey | GNVJNOOHMIVNAH-UHFFFAOYSA-N |