For research use only. Not for therapeutic Use.
2,4-Difluorobenzoic acid (Cat.No:M049763) is a chemical compound used in organic synthesis and medicinal chemistry. With two fluorine atoms, it imparts unique properties to molecules it’s incorporated into. It finds applications in drug discovery, agrochemicals, and material science due to its role as a building block with diverse reactivity.
Catalog Number | M049763 |
CAS Number | 1583-58-0 |
Molecular Formula | C7H4F2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,4-difluorobenzoic acid |
InChI | InChI=1S/C7H4F2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
InChIKey | NJYBIFYEWYWYAN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1F)F)C(=O)O |