For research use only. Not for therapeutic Use.
2,4-Difluorobenzyl bromide is an organohalide compound used as a versatile intermediate in organic synthesis and pharmaceutical research. With two fluorine atoms substituted at the 2 and 4 positions of a benzyl ring, along with a bromine group, it offers unique reactivity, particularly in nucleophilic substitution reactions. This compound is commonly employed in the synthesis of bioactive molecules, agrochemicals, and pharmaceuticals. Its halogenated structure allows for further chemical modifications, making it valuable in drug discovery and the development of complex organic compounds.
CAS Number | 23915-07-3 |
Synonyms | α-Bromo-2,4-difluoro-toluene; 1-(Bromomethyl)-2,4-difluorobenzene; 2,4-Difluorobenzyl Bromide; α-Bromo-2,4-difluorotoluene; 1-(Bromomethyl)-2,4-difluoro-benzene |
Molecular Formula | C7H5BrF2 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 1-(bromomethyl)-2,4-difluorobenzene |
InChI | InChI=1S/C7H5BrF2/c8-4-5-1-2-6(9)3-7(5)10/h1-3H,4H2 |
InChIKey | IBLMYGXJKQIGSN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1F)F)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |