For research use only. Not for therapeutic Use.
2,4-Difluoropyrimidine (Cat.No:L003472) is a key chemical compound with diverse applications in pharmaceutical and agrochemical industries. Its unique fluorinated structure imparts distinctive reactivity and biological properties, making it a valuable building block in the synthesis of various pharmaceutical agents and crop protection chemicals.
| Catalog Number | L003472 |
| CAS Number | 2802-61-1 |
| Molecular Formula | C4H2F2N2 |
| Purity | ≥95% |
| IUPAC Name | 2,4-difluoropyrimidine |
| InChI | InChI=1S/C4H2F2N2/c5-3-1-2-7-4(6)8-3/h1-2H |
| InChIKey | JZSYSXZDIQUOGP-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1F)F |
