Home
>
Reference Standards> 2,4-Dihydro-4-[4-[4-(4-hydroxyphenyl]-1-piperazinyl]phenyl]-2-(1-methylpropyl)-3H-1,2,4-triazol-3-on
For research use only. Not for therapeutic Use.
2,4-dihydro-4-[4-[4-(4-hydroxyphenyl)-1-piperazinyl]phenyl]-2-(1-methyl propyl)-3H-1,2,4-triazol-3-on(Cat No.:R003334). This compound appears to be a complex molecule containing several functional groups, including a triazole ring, a piperazine ring, a hydroxyphenyl group, and a methyl propyl moiety. The compound’s structure suggests that it might have potential pharmacological or biological activity, given its complex arrangement of functional groups. However, more detailed information about its properties uses, and effects would be needed to provide a comprehensive understanding of its characteristics and applications.
CAS Number | 106461-41-0 |
Synonyms | T 1330; |
Molecular Formula | C22H27N5O2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 2-butan-2-yl-4-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
InChI | InChI=1S/C22H27N5O2/c1-3-17(2)27-22(29)26(16-23-27)20-6-4-18(5-7-20)24-12-14-25(15-13-24)19-8-10-21(28)11-9-19/h4-11,16-17,28H,3,12-15H2,1-2H3 |
InChIKey | FFAQILVGBAELHN-UHFFFAOYSA-N |
SMILES | CCC(C)N1C(=O)N(C=N1)C2=CC=C(C=C2)N3CCN(CC3)C4=CC=C(C=C4)O |