For research use only. Not for therapeutic Use.
Flavokawain C(Cat No.:M201612) is a chalcone compound derived from the kava root. It possesses cytotoxic properties against several human cancer cell lines, with an IC50 value of 12.75 μM specifically targeting HCT 116 cells. This natural compound has garnered significant interest in cancer research due to its potential as an anticancer agent. Its ability to selectively induce cell death in cancer cells makes it a promising candidate for further investigation and development in the quest for effective and less toxic cancer therapies.
CAS Number | 37308-75-1 |
Molecular Formula | C17H16O5 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 4°C, protect from light |
IUPAC Name | (E)-1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
InChI | InChI=1S/C17H16O5/c1-21-13-9-15(20)17(16(10-13)22-2)14(19)8-5-11-3-6-12(18)7-4-11/h3-10,18,20H,1-2H3/b8-5+ |
InChIKey | UXUFMIJZNYXWDX-VMPITWQZSA-N |
SMILES | COC1=CC(=C(C(=C1)OC)C(=O)C=CC2=CC=C(C=C2)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |