For research use only. Not for therapeutic Use.
2,4-Dihydroxy-6-methoxyacetophenone (CAT: R025844) holds diverse applications. With an aromatic structure, it serves as a pivotal building block in organic synthesis. Hydroxyl and methoxy groups enable tailored functionalization, crucial for designing bioactive molecules and materials. Though not inherently pharmacologically active, 2,4-Dihydroxy-6-methoxyacetophenone’s versatile role underscores its significance in chemical research, fostering advancements in drug discovery and materials science by facilitating tailored compound creation.
Catalog Number | R025844 |
CAS Number | 3602-54-8 |
Synonyms | 2-O-Methylphloroacetophenone; 2’,4’-Dihydroxy-6’-methoxyacetophenone; 6-O-Methylphloroacetophenone; 2,4-Dihydroxy-6-methoxy-acetophenone; 1-(2,4-Dihydroxy-6-methoxyphenyl)-ethanone |
Molecular Formula | C9H10O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(2,4-dihydroxy-6-methoxyphenyl)ethanone |
InChI | InChI=1S/C9H10O4/c1-5(10)9-7(12)3-6(11)4-8(9)13-2/h3-4,11-12H,1-2H3 |
InChIKey | IETZAWFZIAOWQX-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C=C(C=C1OC)O)O |