For research use only. Not for therapeutic Use.
(2,4-Dimethoxy-6-methylphenyl)boronic acid (CAT: L000170) is a valuable compound with applications in organic chemistry and material science. Its action mechanism involves serving as a boronic acid derivative, making it an essential building block for various chemical reactions. In the realm of organic chemistry, this compound acts as a versatile intermediate for the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals.
CAS Number | 202390-71-4 |
Molecular Formula | C9H13BO4 |
Purity | ≥95% |
IUPAC Name | (2,4-dimethoxy-6-methylphenyl)boronic acid |
InChI | InChI=1S/C9H13BO4/c1-6-4-7(13-2)5-8(14-3)9(6)10(11)12/h4-5,11-12H,1-3H3 |
InChIKey | ZSGPNFZLMYSDAO-UHFFFAOYSA-N |