For research use only. Not for therapeutic Use.
2,4-Dimethoxybenzylamine is an organic compound featuring a benzylamine structure with methoxy groups at the 2- and 4-positions on the phenyl ring. It is commonly used as an intermediate in pharmaceutical research and organic synthesis for developing bioactive molecules, including drugs and agrochemicals. The methoxy groups enhance its reactivity, making it useful in various chemical transformations. This compound’s versatility supports advancements in medicinal chemistry, enabling the synthesis of complex compounds and contributing to drug discovery and the development of fine chemicals.
CAS Number | 20781-20-8 |
Synonyms | 2,4-Dimethoxy-benzylamine; (2,4-Dimethoxyphenyl)methanamine; 2,4-Dimethoxybenzenemethanamine; 2,4-Dimethoxybenzylamine; [(2,4-Dimethoxyphenyl)methyl]amine |
Molecular Formula | C9H13NO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2,4-dimethoxyphenyl)methanamine |
InChI | InChI=1S/C9H13NO2/c1-11-8-4-3-7(6-10)9(5-8)12-2/h3-5H,6,10H2,1-2H3 |
InChIKey | QOWBXWFYRXSBAS-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(C=C1)CN)OC |