For research use only. Not for therapeutic Use.
(2,4-Dimethoxyphenyl)(4-methoxyphenyl)methanone(Cat No.:L006893), is a chemical compound utilized in organic synthesis and pharmaceutical research. Its molecular structure comprises a ketone group sandwiched between a 2,4-dimethoxyphenyl and a 4-methoxyphenyl group. This compound serves as a valuable intermediate in the creation of complex organic molecules. Researchers use it to explore structure-activity relationships and develop new pharmaceuticals and specialty chemicals.
CAS Number | 4038-15-7 |
Molecular Formula | C16H16O4 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | (2,4-dimethoxyphenyl)-(4-methoxyphenyl)methanone |
InChI | InChI=1S/C16H16O4/c1-18-12-6-4-11(5-7-12)16(17)14-9-8-13(19-2)10-15(14)20-3/h4-10H,1-3H3 |
InChIKey | VFTDVICZBGDMMB-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)OC)OC |