For research use only. Not for therapeutic Use.
2,4-Dimethyl-1-hexene (Cat No.:M082852) is a chemical compound with the molecular formula C8H16. It is an alkene with two methyl groups attached to the carbon atoms at positions 2 and 4 of a hexene chain. This compound is used as a building block in organic synthesis for various applications, including the production of polymers and specialty chemicals. Its double bond and branched structure contribute to its reactivity and versatility in chemical reactions. 2,4-Dimethyl-1-hexene’s unique arrangement of atoms makes it valuable in creating diverse molecules, making it useful in the synthesis of various products across industries.
CAS Number | 16746-87-5 |
Molecular Formula | C8H16 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2,4-dimethylhex-1-ene |
InChI | InChI=1S/C8H16/c1-5-8(4)6-7(2)3/h8H,2,5-6H2,1,3-4H3 |
InChIKey | PKVDGQHNRICJLA-UHFFFAOYSA-N |
SMILES | CCC(C)CC(=C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |