For research use only. Not for therapeutic Use.
2,4-Dimethyl-5-oxazolecarboxylic Acid is a heterocyclic compound with potential applications in pharmaceutical and agrochemical research. Featuring a unique oxazole ring structure, this carboxylic acid derivative is of interest for its ability to participate in various chemical reactions, including cyclization and condensation processes. Its dimethyl substitutions enhance its reactivity and steric properties, making it suitable for the synthesis of biologically active molecules. This compound is being explored for its role in developing new antimicrobial agents and other therapeutic candidates. The diverse functionalization possibilities of 2,4-Dimethyl-5-oxazolecarboxylic Acid contribute to its significance in advanced organic synthesis and drug discovery.
CAS Number | 2510-37-4 |
Synonyms | 2,4-Dimethyl-1,3-oxazole-5-carboxylic Acid; 2,4-Dimethyloxazole-5-carboxylic Acid; 5-Carboxy-2,4-dimethyloxazole |
Molecular Formula | C6H7NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,4-dimethyl-1,3-oxazole-5-carboxylic acid |
InChI | InChI=1S/C6H7NO3/c1-3-5(6(8)9)10-4(2)7-3/h1-2H3,(H,8,9) |
InChIKey | JLSFKHJNJFXGAB-UHFFFAOYSA-N |
SMILES | CC1=C(OC(=N1)C)C(=O)O |