For research use only. Not for therapeutic Use.
2,4-Dimethyl-N-(o-tolyl)aniline (Cat.No:L004154) is a significant chemical compound with versatile applications. Its unique structure, featuring methyl and o-tolyl groups, imparts distinct reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized organic molecules, finding applications in pharmaceuticals and materials science.
CAS Number | 155960-55-7 |
Molecular Formula | C15H17N |
Purity | ≥95% |
IUPAC Name | 2,4-dimethyl-N-(2-methylphenyl)aniline |
InChI | InChI=1S/C15H17N/c1-11-8-9-15(13(3)10-11)16-14-7-5-4-6-12(14)2/h4-10,16H,1-3H3 |
InChIKey | NCCQDZNBYWMIES-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)NC2=CC=CC=C2C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |