For research use only. Not for therapeutic Use.
2′,4′-Dimethylacetophenone(Cat No.:I015095) is an endogenous metabolite that naturally occurs within the body. It is a derivative of acetophenone, a ketone compound. Although its specific functions and roles in biological processes are not extensively studied, endogenous metabolites like 2′, and 4′-dimethylacetophenone are involved in various physiological pathways and contribute to the overall metabolism of the body.
Catalog Number | I015095 |
CAS Number | 89-74-7 |
Molecular Formula | C₁₀H₁₂O |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | 1-(2,4-dimethylphenyl)ethanone |
InChI | InChI=1S/C10H12O/c1-7-4-5-10(9(3)11)8(2)6-7/h4-6H,1-3H3 |
InChIKey | HSDSKVWQTONQBJ-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)C(=O)C)C |