For research use only. Not for therapeutic Use.
,4-Dimethylbenzenesulfonic acid (Cat.No:L004199) is a vital organic compound in chemical synthesis. Known for its sulfonic acid functionality, it finds extensive use as a catalyst and reagent in various industrial processes. This compound serves as a key intermediate in the production of dyes, pharmaceuticals, and agrochemicals.
Catalog Number | L004199 |
CAS Number | 88-61-9 |
Molecular Formula | C8H10O3S |
Purity | ≥95% |
IUPAC Name | 2,4-dimethylbenzenesulfonic acid |
InChI | InChI=1S/C8H10O3S/c1-6-3-4-8(7(2)5-6)12(9,10)11/h3-5H,1-2H3,(H,9,10,11) |
InChIKey | CHZLVSBMXZSPNN-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)S(=O)(=O)O)C |