For research use only. Not for therapeutic Use.
2,4-Dimethylbenzenesulfonic acid dihydrate (Cat.No:L004202) is a pivotal organic compound used extensively in chemical synthesis. Its sulfonic acid functionality grants it valuable reactivity, making it a crucial catalyst and reagent in various industrial processes. This compound plays a key role in the production of dyes, pharmaceuticals, and agrochemicals.
| Catalog Number | L004202 |
| CAS Number | 92558-30-0 |
| Molecular Formula | C8H14O5S |
| Purity | ≥95% |
| IUPAC Name | 2,4-dimethylbenzenesulfonic acid;dihydrate |
| InChI | InChI=1S/C8H10O3S.2H2O/c1-6-3-4-8(7(2)5-6)12(9,10)11;;/h3-5H,1-2H3,(H,9,10,11);2*1H2 |
| InChIKey | PCMSCWFZBHVERE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)O)C.O.O |
