For research use only. Not for therapeutic Use.
2,4-Dimethylcinnamic acid(Cat No.:M120846)is a high-purity organic compound widely used in pharmaceutical and chemical research. Featuring a cinnamic acid backbone with dimethyl substitution at the 2 and 4 positions, this compound is a valuable intermediate in the synthesis of various complex molecules, including pharmaceuticals, fragrances, and agrochemicals. Its unique structure and reactivity make it ideal for use in the development of new therapeutic agents and materials. This compound is particularly important in medicinal chemistry, where it supports innovative drug discovery and the exploration of bioactive compounds.
CAS Number | 1685-80-9 |
Molecular Formula | C11H12O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (E)-3-(2,4-dimethylphenyl)prop-2-enoic acid |
InChI | InChI=1S/C11H12O2/c1-8-3-4-10(9(2)7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+ |
InChIKey | UFSZMHHSCOXWPC-AATRIKPKSA-N |
SMILES | CC1=CC(=C(C=C1)C=CC(=O)O)C |