For research use only. Not for therapeutic Use.
2,4-Dinitrophenylhydrazine-13C6 is a fully labeled carbon-13 compound, featuring six 13C atoms for enhanced stability and precision in research. This isotopically labeled compound is essential for studying the reactivity, metabolic pathways, and detection of carbonyl compounds. 2,4-Dinitrophenylhydrazine-13C6 ensures reliable and consistent results in advanced analytical techniques, such as mass spectrometry and NMR spectroscopy, making it a valuable tool for scientists and researchers. Its high purity and stable isotopic labeling support accurate tracking and quantification in various chemical and biochemical studies.
CAS Number | 882513-61-3 |
Synonyms | (2,4-Dinitrophenyl-13C6)hydrazine; (2,4-Dinitrophenyl-1,2,3,4,5,6-13C6)hydrazine; |
Molecular Formula | C6H6N4O4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (2,4-dinitrophenyl)hydrazine |
InChI | InChI=1S/C6H6N4O4/c7-8-5-2-1-4(9(11)12)3-6(5)10(13)14/h1-3,8H,7H2/i1+1,2+1,3+1,4+1,5+1,6+1 |
InChIKey | HORQAOAYAYGIBM-IDEBNGHGSA-N |
SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])NN |