For research use only. Not for therapeutic Use.
2,4′-Diphenylmethane diisocyanate (Cat No.:M014959) is a variant of methylene diphenyl diisocyanate, a crucial chemical used in the production of polyurethane foams and other polyurethane-based materials. This compound features two isocyanate groups attached to a benzene ring, which are highly reactive with alcohols to form polyurethanes. The 2,4′-MDI is specifically valued for its ability to create rigid and semi-rigid foam products due to its strong cross-linking capabilities. It is extensively used in industries such as construction, automotive, and insulation, where durable and energy-absorbing materials are essential.
CAS Number | 5873-54-1 |
Synonyms | 1-isocyanato-2-[(4-isocyanatophenyl)methyl]-benzen;1-isocyanato-2-[(4-isocyanatophenyl)methyl]-Benzene;2,4’-methylenediphenylenediisocyanate;benzene,1-isocyanato-2-[(4-isocyanatophenyl)methyl;benzene,1-isocyanato-2-[4-isocyanatophenyl)methyl]-;Diphen |
Molecular Formula | C15H10N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-isocyanato-2-[(4-isocyanatophenyl)methyl]benzene |
InChI | InChI=1S/C15H10N2O2/c18-10-16-14-7-5-12(6-8-14)9-13-3-1-2-4-15(13)17-11-19/h1-8H,9H2 |
InChIKey | LFSYUSUFCBOHGU-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)CC2=CC=C(C=C2)N=C=O)N=C=O |