For research use only. Not for therapeutic Use.
2,4-Pyridinedicarboxylic acid, also known as dipicolinic acid, is a pyridine derivative with two carboxylic acid groups (-COOH) at the 2 and 4 positions. It is notable for its role as a biomarker for bacterial spores and is abundant in bacterial endospores, such as those formed by Bacillus species. Dipicolinic acid contributes to the heat resistance and stability of bacterial spores. Research explores its functions in spore formation and its potential applications in microbiology and biotechnology.
| Catalog Number | R061623 |
| CAS Number | 499-80-9 |
| Synonyms | 2,4-Dicarboxylpyridine; 2,4-Lutidinic acid; Lutidinic acid; NSC 403248 |
| Molecular Formula | C7H5NO4 |
| Purity | ≥95% |
| Target | Histone Demethylase |
| Solubility | >9.15mg/mL in DMSO |
| Storage | Store at -20C |
| IUPAC Name | pyridine-2,4-dicarboxylic acid |
| InChI | InChI=1S/C7H5NO4/c9-6(10)4-1-2-8-5(3-4)7(11)12/h1-3H,(H,9,10)(H,11,12) |
| InChIKey | MJIVRKPEXXHNJT-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(=O)O)C(=O)O |
