For research use only. Not for therapeutic Use.
2,4-Pyrimidinediamine, 6-methyl- (9CI) is an organic compound featuring a pyrimidine ring with two amino groups at the 2 and 4 positions, and a methyl group at the 6 position. It serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Its pyrimidine core is crucial in developing bioactive molecules, including enzyme inhibitors and receptor modulators. This compound is widely used in medicinal chemistry for drug discovery and the development of therapeutic agents targeting various biological pathways.
CAS Number | 1791-73-7 |
Molecular Formula | C5H8N4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6-methylpyrimidine-2,4-diamine |
InChI | InChI=1S/C5H8N4/c1-3-2-4(6)9-5(7)8-3/h2H,1H3,(H4,6,7,8,9) |
InChIKey | HERHQNVDSHUKAK-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC(=N1)N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |