For research use only. Not for therapeutic Use.
2,4,5-Trifluorobenzyl alcohol(Cat No.:M099646)is an aromatic alcohol used in organic synthesis and pharmaceutical research. The molecule features a benzyl alcohol core with fluorine atoms at the 2, 4, and 5 positions, providing unique electronic properties and reactivity. This compound is valuable as an intermediate in the synthesis of complex molecules, particularly in the development of pharmaceuticals and agrochemicals. The presence of multiple fluorine atoms can enhance the stability and bioavailability of derived compounds, making it essential for researchers focused on drug discovery, medicinal chemistry, and the creation of advanced materials.
CAS Number | 144284-25-3 |
Molecular Formula | C7H5F3O |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | (2,4,5-trifluorophenyl)methanol |
InChI | InChI=1S/C7H5F3O/c8-5-2-7(10)6(9)1-4(5)3-11/h1-2,11H,3H2 |
InChIKey | NRXZCCOHXZFHBV-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1F)F)F)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |