For research use only. Not for therapeutic Use.
2,4,5-Trimethylaniline hydrochloride(Cat No.:L006814). It consists of an aniline ring substituted with three methyl groups at the 2-, 4-, and 5-positions and a chloride ion. This compound is crucial in organic synthesis and chemical research. Its unique structure allows for diverse chemical transformations, making it valuable as a reagent in various chemical reactions. Researchers use it as a building block for the synthesis of complex organic molecules, contributing to advancements in drug discovery, materials science, and the development of specialized organic compounds for industrial applications.
CAS Number | 21436-97-5 |
Molecular Formula | C9H14ClN |
Purity | ≥95% |
IUPAC Name | 2,4,5-trimethylaniline;hydrochloride |
InChI | InChI=1S/C9H13N.ClH/c1-6-4-8(3)9(10)5-7(6)2;/h4-5H,10H2,1-3H3;1H |
InChIKey | HPSNPQBFMPYUOD-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1C)N)C.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |