For research use only. Not for therapeutic Use.
2,4,5,6-Tetraaminopyrimidine(CAT: M069516) is a high-purity heterocyclic compound featuring four amino groups symmetrically positioned on a pyrimidine ring. This highly functionalized molecule is widely utilized in pharmaceutical, agricultural, and material science research as a precursor for synthesizing bioactive compounds, dyes, and advanced materials. Its structure makes it suitable for various chemical transformations, including cyclizations and condensation reactions, enabling the development of complex heterocyclic frameworks. With consistent quality and excellent reactivity, 2,4,5,6-Tetraaminopyrimidine is a valuable reagent for advancing innovative research in medicinal chemistry and synthetic organic chemistry.
CAS Number | 1004-74-6 |
Molecular Formula | C4H8N6 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | pyrimidine-2,4,5,6-tetramine |
InChI | InChI=1S/C4H8N6/c5-1-2(6)9-4(8)10-3(1)7/h5H2,(H6,6,7,8,9,10) |
InChIKey | PZRKPUQWIFJRKZ-UHFFFAOYSA-N |
SMILES | C1(=C(N=C(N=C1N)N)N)N |