For research use only. Not for therapeutic Use.
2,4,5,6-Tetrachlorophenol-13C6 is an isotopically labeled version of 2,4,5,6-tetrachlorophenol, where all six carbon atoms in the phenol ring are replaced with carbon-13. This compound is used in environmental, toxicological, and analytical research to study the behavior, degradation, and environmental impact of chlorinated phenols, which are often found as pollutants. The carbon-13 labeling allows for precise tracking and enhanced accuracy in analytical techniques such as nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, making it easier to monitor the presence and transformation of the compound in various environmental matrices. 2,4,5,6-Tetrachlorophenol-13C6 is valuable for researchers focused on understanding the fate and transport of chlorinated phenols in the environment, assessing their toxicological effects, and developing strategies for pollution control and remediation.
Catalog Number | R013360 |
CAS Number | 1246820-81-4 |
Synonyms | 2,3,4,6-Tetrachloro-phenol-13C6; 2,3,4,6-Tetrachlorophenate13C6; Dowicide 6-13C6; NSC 2428-13C6; |
Molecular Formula | C6H2Cl4O |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2,3,4,6-tetrachlorophenol |
InChI | InChI=1S/C6H2Cl4O/c7-2-1-3(8)6(11)5(10)4(2)9/h1,11H/i1+1,2+1,3+1,4+1,5+1,6+1 |
InChIKey | VGVRPFIJEJYOFN-IDEBNGHGSA-N |
SMILES | [13CH]1=[13C]([13C](=[13C]([13C](=[13C]1Cl)Cl)Cl)O)Cl |