For research use only. Not for therapeutic Use.
2,4,5,6-Tetrachloropyrimidine is a chlorinated heterocyclic compound used in pharmaceutical research and organic synthesis. With four chlorine atoms substituted on the pyrimidine ring, it serves as a versatile building block for the development of bioactive molecules, agrochemicals, and advanced materials. Its highly reactive structure allows for diverse chemical modifications, making it an important intermediate in the synthesis of novel compounds. This compound is particularly useful in medicinal chemistry for designing inhibitors, drugs, and other biologically relevant substances.
| Catalog Number | M058542 |
| CAS Number | 14121-36-9 |
| Molecular Formula | C5HCl4N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,3,4,6-tetrachloropyridine |
| InChI | InChI=1S/C5HCl4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
| InChIKey | FZFNDUTVMQOPCT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)Cl)Cl |
