For research use only. Not for therapeutic Use.
2,4,5,7-Tetraiodo-6-hydroxy-3-fluorone(Cat No.:M094997) is a chemically synthesized compound characterized by multiple iodine atoms and a fluorone core. The presence of four iodine atoms and a hydroxyl group makes this molecule highly reactive and useful in various chemical applications. Its structure suggests potential use in imaging technologies, particularly in fields requiring high-contrast agents, due to the heavy iodine content which can block X-rays. Additionally, the fluorone base provides a platform for fluorescence, suggesting applications in fluorescent tagging and molecular probes, and enhancing visualization in biological and medical research.
CAS Number | 142189-38-6 |
Molecular Formula | C13H4I4O3 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 6-hydroxy-2,4,5,7-tetraiodoxanthen-3-one |
InChI | InChI=1S/C13H4I4O3/c14-6-2-4-1-5-3-7(15)11(19)9(17)13(5)20-12(4)8(16)10(6)18/h1-3,18H |
InChIKey | KBKHBHIMPFUQBK-UHFFFAOYSA-N |
SMILES | C1=C2C=C(C(=O)C(=C2OC3=C(C(=C(C=C31)I)O)I)I)I |