For research use only. Not for therapeutic Use.
2,4,6-Tribromophenyl N-Hexanoate(Cat No.:M087013)is a specialized compound used in pharmaceutical and chemical research. It features a tribromophenyl group attached to an N-hexanoate moiety, offering unique reactivity for organic synthesis and analytical applications. This compound is valuable in studies related to aromatic halogenation, molecular interactions, and structure-activity relationships. Its stable chemical structure makes it suitable for diverse research, including the development of novel pharmaceutical agents. 2,4,6-Tribromophenyl N-Hexanoate is essential for researchers focused on advanced chemical synthesis and functional group transformations.
CAS Number | 16732-09-5 |
Molecular Formula | C12H13Br3O2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | (2,4,6-tribromophenyl) hexanoate |
InChI | InChI=1S/C12H13Br3O2/c1-2-3-4-5-11(16)17-12-9(14)6-8(13)7-10(12)15/h6-7H,2-5H2,1H3 |
InChIKey | WKADNUIXFNFRSW-UHFFFAOYSA-N |
SMILES | CCCCCC(=O)OC1=C(C=C(C=C1Br)Br)Br |