For research use only. Not for therapeutic Use.
2,4,6-Tribromophenylboronic acid (Cat.No:L003607) is a pivotal chemical compound in organic synthesis. Its distinctive boronic acid functionality, combined with the presence of three bromine atoms, makes it a versatile building block for the preparation of complex molecules. This compound is particularly valuable in the field of medicinal chemistry, where it serves as a key intermediate for the development of pharmaceutical agents.
CAS Number | 1451392-84-9 |
Molecular Formula | C6H4BBr3O2 |
Purity | ≥95% |
IUPAC Name | (2,4,6-tribromophenyl)boronic acid |
InChI | InChI=1S/C6H4BBr3O2/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,11-12H |
InChIKey | YQXRXSNADQHKTI-UHFFFAOYSA-N |
SMILES | B(C1=C(C=C(C=C1Br)Br)Br)(O)O |