For research use only. Not for therapeutic Use.
2,4,6-Trichloropyridin-3-amine(Cat No.:L035849)is a chemical compound with the molecular formula C5H3Cl3N2. This compound features a pyridine ring substituted with three chlorine atoms and an amine group at the 3-position. It is used primarily as an intermediate in the synthesis of agricultural chemicals, pharmaceuticals, and dyes. The chlorine substituents enhance its reactivity, facilitating electrophilic substitution reactions that are crucial for building complex organic molecules. The presence of the amine group also allows for further functionalization, making it a versatile building block in creating compounds with specific biological or chemical properties.
Catalog Number | L035849 |
CAS Number | 91872-08-1 |
Molecular Formula | C5H3Cl3N2 |
Purity | ≥95% |
IUPAC Name | 2,4,6-trichloropyridin-3-amine |
InChI | InChI=1S/C5H3Cl3N2/c6-2-1-3(7)10-5(8)4(2)9/h1H,9H2 |
InChIKey | DUJCPIVNSCGBIH-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(N=C1Cl)Cl)N)Cl |