For research use only. Not for therapeutic Use.
2,4,6-Trihydroxybenzoic Acid(Cat No.:R015831), also known as phloroglucinol carboxylic acid, is a phenolic compound with notable antioxidant, anti-inflammatory, and antimicrobial properties. It is commonly used in pharmaceutical and biochemical research for its ability to scavenge free radicals and reduce oxidative stress. Additionally, this compound is involved in various metabolic pathways and can serve as an intermediate in the synthesis of other biologically active molecules. Its protective effects on cells make it valuable for studies related to oxidative damage, aging, and the development of therapeutic agents.
CAS Number | 83-30-7 |
Synonyms | 2,4,6-Trihydroxybenzenecarboxylic Acid; NSC 36720; Phloroglucinic Acid; Phloroglucinolcarboxylic Acid |
Molecular Formula | C7H6O5 |
Purity | ≥95% |
Target | CDK |
Storage | -20°C |
IUPAC Name | 2,4,6-trihydroxybenzoic acid |
InChI | InChI=1S/C7H6O5/c8-3-1-4(9)6(7(11)12)5(10)2-3/h1-2,8-10H,(H,11,12) |
InChIKey | IBHWREHFNDMRPR-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1O)C(=O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |