For research use only. Not for therapeutic Use.
2,4,6-Trimethoxyamphetamine (TMA-6)(CAT: R060887) is a psychedelic amphetamine analog with three methoxy groups on the aromatic ring. Its psychoactive effects are linked to its agonism of the 5-HT2A receptor, leading to altered perception, mood changes, and visual distortions. As a derivative of mescaline, TMA-6 has been studied for its potential in psychopharmacology, exploring its influence on cognition and sensory processing. Its hydrochloride form enhances solubility, making it more manageable for research purposes. Due to its potent effects, TMA-6 is typically restricted to controlled environments, where it helps investigate serotonin’s role in perception and consciousness.
| Catalog Number | R060887 |
| CAS Number | 23815-74-9 |
| Synonyms | TMA-6 |
| Molecular Formula | C12H20ClNO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(2,4,6-trimethoxyphenyl)propan-2-amine;hydrochloride |
| InChI | InChI=1S/C12H19NO3.ClH/c1-8(13)5-10-11(15-3)6-9(14-2)7-12(10)16-4;/h6-8H,5,13H2,1-4H3;1H |
| InChIKey | HAIHNGCKJFYVFH-UHFFFAOYSA-N |
| SMILES | CC(CC1=C(C=C(C=C1OC)OC)OC)N.Cl |
