For research use only. Not for therapeutic Use.
2,4,6-Trimethoxybenzene-1,3,5-tricarbaldehyde(CAT: L003995) is a high-purity aromatic compound widely utilized in pharmaceutical, material science, and organic synthesis research. Featuring three aldehyde groups and three methoxy substituents on a benzene ring, this compound is a versatile building block for designing complex organic molecules, functional materials, and dendrimers. Its unique structure makes it particularly valuable in applications such as polymer chemistry, ligand synthesis, and medicinal chemistry. With excellent stability and reactivity, 2,4,6-Trimethoxybenzene-1,3,5-tricarbaldehyde ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
CAS Number | 680575-17-1 |
Molecular Formula | C12H12O6 |
Purity | ≥95% |
IUPAC Name | 2,4,6-trimethoxybenzene-1,3,5-tricarbaldehyde |
InChI | InChI=1S/C12H12O6/c1-16-10-7(4-13)11(17-2)9(6-15)12(18-3)8(10)5-14/h4-6H,1-3H3 |
InChIKey | PGHSMJSBERHVLW-UHFFFAOYSA-N |
SMILES | COC1=C(C(=C(C(=C1C=O)OC)C=O)OC)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |