For research use only. Not for therapeutic Use.
2,4,6-Trimethoxybenzoic acid(CAT: L046908) is a high-purity aromatic compound featuring a benzoic acid core substituted with three methoxy groups at the 2-, 4-, and 6-positions. This versatile molecule is widely utilized in pharmaceutical and chemical research as a key intermediate for synthesizing complex organic compounds and bioactive molecules. Its unique structure, combining electron-donating methoxy groups with a carboxylic acid functionality, makes it valuable for medicinal chemistry applications, including the development of novel therapeutic agents. With reliable quality and excellent stability, 2,4,6-Trimethoxybenzoic acid supports innovative research in drug discovery, organic synthesis, and material science.
CAS Number | 570-02-5 |
Molecular Formula | C10H12O5 |
Purity | ≥95% |
IUPAC Name | 2,4,6-trimethoxybenzoic acid |
InChI | InChI=1S/C10H12O5/c1-13-6-4-7(14-2)9(10(11)12)8(5-6)15-3/h4-5H,1-3H3,(H,11,12) |
InChIKey | JATAKEDDMQNPOQ-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(C(=C1)OC)C(=O)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |