For research use only. Not for therapeutic Use.
2,4,6-Tris(4-aminophenyl)-1,3,5-triazine is an aromatic triazine compound with three aminophenyl groups, used primarily in materials science and polymer chemistry. Its highly functionalized structure makes it an excellent building block for creating high-performance polymers, resins, and supramolecular assemblies. The amino groups provide multiple reactive sites for further chemical modifications, enabling its application in the synthesis of dyes, adhesives, and advanced materials. This compound plays a crucial role in developing durable and thermally stable materials for various industrial and research applications.
CAS Number | 14544-47-9 |
Molecular Formula | C21H18N6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[4,6-bis(4-aminophenyl)-1,3,5-triazin-2-yl]aniline |
InChI | InChI=1S/C21H18N6/c22-16-7-1-13(2-8-16)19-25-20(14-3-9-17(23)10-4-14)27-21(26-19)15-5-11-18(24)12-6-15/h1-12H,22-24H2 |
InChIKey | WHSQATVVMVBGNS-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=NC(=NC(=N2)C3=CC=C(C=C3)N)C4=CC=C(C=C4)N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |