For research use only. Not for therapeutic Use.
2,4,6-Tris(dichloromethyl)-1,3,5-trioxane(Cat No.:M084149) is a synthetic organic compound featuring a trioxane ring — a three-membered ring containing three oxygen atoms — with dichloromethyl groups attached to each carbon. This structure makes it highly reactive and useful in chemical synthesis, particularly as a precursor or intermediate in the production of other complex molecules. The presence of both chloro groups and a trioxane ring suggests potential applications in polymer chemistry or as a building block in the synthesis of various halogenated compounds.
CAS Number | 17352-16-8 |
Molecular Formula | C6H6Cl6O3 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 2,4,6-tris(dichloromethyl)-1,3,5-trioxane |
InChI | InChI=1S/C6H6Cl6O3/c7-1(8)4-13-5(2(9)10)15-6(14-4)3(11)12/h1-6H |
InChIKey | WHRHHWJTZCPFFS-UHFFFAOYSA-N |
SMILES | C1(OC(OC(O1)C(Cl)Cl)C(Cl)Cl)C(Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |