For research use only. Not for therapeutic Use.
2,4,6-Tris(dimethylaminomethyl)phenol consists of a phenol ring substituted with three dimethylaminomethyl groups at the 2nd, 4th, and 6th positions. This compound is commonly used as a catalyst or reagent in organic synthesis, particularly in the production of polymers, resins, and pharmaceuticals. Its tri-functional nature allows it to participate in various reactions, making it valuable in the synthesis of complex molecules and as a building block in the chemical industry.
CAS Number | 90-72-2 |
Molecular Formula | C15H27N3O |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 2,4,6-tris[(dimethylamino)methyl]phenol |
InChI | InChI=1S/C15H27N3O/c1-16(2)9-12-7-13(10-17(3)4)15(19)14(8-12)11-18(5)6/h7-8,19H,9-11H2,1-6H3 |
InChIKey | AHDSRXYHVZECER-UHFFFAOYSA-N |
SMILES | CN(C)CC1=CC(=C(C(=C1)CN(C)C)O)CN(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |